Senyawa 2 Metil 1 Pentanol Berisomer Dengan

Senyawa 2 Metil 1 Pentanol Berisomer Dengan.

Cak bertanya dan pembahasan kimia karbon

  1. Paduan 2-metil 1-pentanol berisomer dengan…
    1. metil propil eter
    2. dipropil eter
    3. isopentanol
    4. etil propil eter
    5. 3-pentanol
    6. Jawaban: b
      Alasan: Jumlah unsur C pada soal adalah 6. Pada jawaban, yang kuantitas unsur C-nya 6 adalah dipropil eter. Jumlah atom C bagi opsi: (a) 4, (b) 6, (c) 5, (d) 5, (e) 5

  2. Senyawa berikut nan bukan isomer dari C4H10O yakni…

    1. dietil eter
    2. tersier butil alkohol
    3. dietil keton
    4. 2-metil 2-propanol
    5. metil propil eter
    6. Jawaban: c
      Alasaan: C4H10O yakni gugus keistimewaan alkohol/ eter dan gugus alkanon (keton) tidak isomer dari alkohol ataupun eter.

  3. Senyawa berikut nan merupakan pasangan isomer…
    1. horizon-heksana dengan sikloheksana
    2. pentana dengan 2-metil butana
    3. butana dengan butuna
    4. propana dengan propena
    5. 2,3-dimetil pentena dengan 2-pentena
    6. Jawaban: b
      Alasan: Besaran atom C dan H separas. Siklo alkana berisomer dengan alkena, alkana tidak berisomer dengan alkena.

  4. 2,2-dietil heksanal berisomer dengan…
    1. nonanal
    2. heptanal
    3. dekanal
    4. oktanal
    5. 3,3-dimetil heksanal
    6. Jawaban: c
      Alasan: 2,2-dietil heksanal mempunyai total atom C sebanyak 10, jelas bahwa isomernya adalah dekanal.

  5. CH3-C(CH3)2-CHO berisomer dengan…
    1. CH3-CH2-CH2-CHO
    2. CH3-C(CH3)2-CH2-OH
    3. CH3-CH2-CH2-CH2-CHO
    4. CH3-CO-C2H5
    5. CH3-CH2-CH2-CH2-COOH
    6. Jawaban: c
      Alasan: CH3-C(CH3)2-CHO yakni gugus alkanal. Isomer semenjak alkanal adalah keton, namun lega opsi (d) jumlah elemen C-nya tidak sama. Makara jawabannya merupakan opsi c.

  6. Diketahui rumus struktur laksana berikut:

    (1) CH3CH
    2CH2CH2OH

    (2) CH3CH2CH(OH)CH3

    (3) CH3CH(CH3)CH2OH

    (4) C(CH3)3OH

    Yang merupakan isomer posisi dan kembali isomer lembaga adalah…

    1. 1 dan 2
    2. 1 dan 3
    3. 2 dan 3
    4. 3 dan 4
    5. 4
    6. Jawaban: d
      Alasan: Isomer posisi yaitu isomer nan farik letak gugus fungsinya. Isomer rangka adalah isomer yang berbeda panjang rantainya (galibnya rantai harfiah dengan rantai silang). Yang memenuhi dari pengertian di atas adalah opsi d.

  7. Pasangan yang berisomer geometris adalah…
    1. CH2BrCH2Br dan CH3CH2Br
    2. CHBrCHBr dan CH2CHBr
    3. CHBrCHBr dan BrCHCHBr
    4. C2H5COH dan C2H5CHO
    5. C2H5COOCH3
      dan CH3COOC2H5
    6. Jawaban: c
      Alasan: CHBrCHBr merupakan isomer isomer chis dan BrCHCHBr isomer trans

  8. Tera senyawa CH2Br-CHI-CHCl2
    merupakan…
    1. 1-bromo 3-kloro 2-iodo propana
    2. 3-bromo 1-kloro 2-iodo propana
    3. 1-bromo 3,3-dikloro 2-iodo propana
    4. 3-bromo 1,1-dikloro 2-iodo propana
    5. 1,2,3-tribromo kloro iodo propana
    6. Jawaban: d
      Alasan: Pengangkaan rantai diprioritaskan pada halogen yang minimal perseptif (dalam hal ini Cl) sehingga Cl bernas pada kalung nomor 1.

  9. Dikloro metana dapat dibuat berasal metana dan klorin melangkahi reaksi…
    1. Substitusi
    2. netralisasi
    3. adisi
    4. redoks
    5. peminggiran
    6. Jawaban: a
      Alasan: cak bagi mendapatkan CH2Cl2
      diperlukan reaksi substitusi sebanyak 2 kelihatannya dari CH4
      yang dialiri gas Cl2
      dengan katalis sinar UV. Hasil berpunca reaksi ini adalah CH3Cl dan HCl. CH3Cl ini direaksikan juga dengan asap Cl2
      sehingga didapatkan CH2Cl2.

  10. Reaksi: CH3-CH=CH2
    + HCl menghasilkan…
    1. 2-kloro propana
    2. 3-kloro propana
    3. 1,3-dikloro propana
    4. 1-kloro propana
    5. 1,2-dikloro propana
    6. Jawaban: a
      Alasan: Kombinasi rangkap pada 1-propena akan pecah dan atom H pada HCl akan terikat puas unsur C dengan pertautan rangkap yang pecah yang mengikat molekul H terbanyak dan Cl terbawa pada unsur C dengan ikatan rangkap yang lain.

  11. Haloalkana yang gabungan digunakan seumpama pemadam kebakaran ialah…
    1. DDT
    2. C2H5Br
    3. bromo etana
    4. C2H5Cl
    5. CCl4
    6. Jawaban: e

  12. Senyawa haloalkana yang digunakan laksana zat anti septik pada luka adalah…
    1. freon
    2. PVC
    3. kloroform
    4. iodoform
    5. DDT
    6. Jawaban: d

  13. Nama senyawa berikut adalah…
    1. 4-metil 2-kloro pentana
    2. 2-metil 4-kloro pentana
    3. 2,4-dikloro pentana
    4. 1,4-dikloro 2-metil pentana
    5. 1,3-dikloro pentana
    6. Jawaban: d
      Alasan: Gugus halogen diprioritaskan, karena pada rantai CH2Cl terwalak cabang alkil (n domestik keadaan ini metil) maka pada rantai tersebut diberi nomor 1.

  14. Zat-zat berikut banyak digunakan n domestik arwah sehari-hari. Zat yang mengandung unsur halogen adalah…
    1. freon
    2. sakarin
    3. vetsin
    4. tetoron
    5. urea
    6. Jawaban: a
      Alasan: Freon merupakan riuk satu cabang bersumber CFC (Cloro Fluoro Carbon).

  15. Terwalak beberapa jenis alkohol sebagai berikut:
  16. (1) 2-propanol

    (2) 2-metil 2-propanol

    (3) 3-pentanol

    (4) 2,2-dimetil propanol

    Senyawa yang jika dioksidasi menghasilkan keton ialah…

    1. 1 dan 3
    2. 1 dan 2
    3. 1 dan 4
    4. 2 dan 3
    5. 2 dan 4
    6. Jawaban: a
      Alasan: Alkohol yang menghasilkan keton (alkanon) jika dioksidasi ialah alkohol sekunder.

  17. Suatu senyawa C5H12Ozon boleh bereaksi dengan Na dan jika dioksidasi akan menghasilkan zat yang dapat memerahkan lakmus. Paduan tersebut ialah…
    1. 1-pentanol
    2. 3-pentanol
    3. 3-metil 2-butanol
    4. 2-pentanol
    5. 2-metil 2-butanol
    6. Jawaban: a
      Alasan: Senyawa di atas merupakan alkohol/ eter. Karena dapat bereaksi dengan logam Na, maka senyawa tersebut adalah alkohol. Jikalau dioksidasi boleh memerahkan lakmus, berarti berkepribadian asam seandainya dioksidasi. Maka hasil oksidasinya adalah bersut karboksilat (oksidasinya lengkap). Bersut karboksilat cuma dihasilkan dari oksidasi teoretis alkohol primer.

  18. Pada reaksi antara C2H5OH dengan ferum Na proses nan terjadi merupakan…
    1. substitusi OH oleh Na
    2. substitusi H nan terpikat puas O oleh Na
    3. substitusi H yang terikat pada C makanya Na
    4. substitusi semua maka itu Na
    5. terputusnya hubungan antara kedua zarah C
    6. Jawaban: b
      Alasan: Reaksi substitusi hanya menyebabkan pertukaran
      1 atom
      saja. Puas reaksi di atas, H yang tertawan pada O digantikan oleh Na.

  19. Jika 2-butanol dioksidasi, zat nan terlatih adalah…
    1. propanon
    2. butanal
    3. aseton
    4. cemberut butanoat
    5. butanon
    6. Jawaban: e
      Alasan: 2-butanol adalah alkohol sekunder, maka jika dioksidasi akan menghasilkan keton dengan total unsur C yang seimbang dan letak gugus faedah nan sama lagi.

  20. Alkohol sekunder jika dioksidasi dengan kalium dikromat dalam suasana bersut sulfat melemah, menghasilkan…
    1. keton
    2. alkena
    3. aldehid
    4. karbohidrat
    5. eter
    6. Jawaban: a

  21. Senyawa nan tercatat alkohol polihidroksi merupakan…
    1. etanol
    2. gliserol
    3. butanol
    4. lemak
    5. zat putih telur
    6. Jawaban: b
      Alasan: Alkohol polihidroksi adalah alkohol nan mempunyai gugus -OH lebih dari satu. Pada gliserol terdapat gugus -OH sebanyak 3. Untuk glikol terwalak -OH sebanyak 2.

  22. Suatu campuran organik X memiliki Mr=60 dan mengandung 60% runyam atom C, 13,3% H dan 26,7% Udara murni. Jikalau X dioksidasi menghasilkan senderut karboksilat. Zat X tersebut adalah…
    1. asam asetat
    2. 1-propanol
    3. propanal
    4. 2-propanol
    5. propanon
    6. Jawaban:a

  23. Diantara senyawa berikut nan tergolong eter yaitu…
    1. CH3CH(C2H5)COCH3
    2. (CH3)2CHCH(OH)C2H5
    3. CH3CH2
      CHO
    4. CH3
      OCOCH3
    5. CH2CHOCH3C2H5
    6. Jawaban: e
      Alasan: Gugus kemujaraban eter adalah -O-. (a) adalah gugus alkanon/ keton, (b) adalah alkohol, (c) adalah aldehid, (d) ester, (e) eter.

  24. Bila dibandingkan rasam-rasam eter dengan alkohol yang sesuai yaitu
    1. eter kian mudah larut intern air
    2. eter lebih mudah memasap
    3. eter bertambah tanggap
    4. eter tak bereaksi dengan PCl5
    5. eter tidak terbakar
    6. Jawaban: b
      Alasan: Tutul didih eter lebih terbatas daripada alkohol

  25. Senyawa berikut nan dapat digunakan bagaikan penawar bius adalah…
    1. metanol
    2. gliserol
    3. etanol
    4. dietil eter
    5. glikol
    6. Jawaban: d

  26. campuran A (C4H10Ozon) tidak bereaksi dengan logam Na. Campuran A dengan hancuran HI bersisa menghasilkan senyawa B, C dan H2O. Hidrolisis paduan C menghasilkan 2-propanol. Senyawa A tersebut ialah…
    1. metil isopropil eter
    2. tersier butil alkohol
    3. metil n-propil eter
    4. isobutil alkohol
    5. sekunder butli alkohol
    6. Jawaban: a
      Alasan: Senyawa A bukan bereaksi dengan Na, menunjukkan bahwa senyawa A adalah sintesis eter. Eter jika bereaksi dengan HI terlalu, akan menghasilkan R-I, R’-I, dan H2Udara murni. Hasil hidrolisisnya adalah 2-propanol (alkohol sekunder), jadi yang dihidrolisis adalah R-I. Karena risikonya adalah alkohol sekunder, maka R=isopropil. Residu atom C sebanyak 1. Makara logo senyawa eter tersebut merupakan metil isopropil eter.

  27. Nama paduan berikut merupakan…

    1. 2,2-dimetil 3,3-dietil butanal
    2. 2,2-dietil 3,3-dimetil butanal
    3. 2,3-dietil 2,3-dimetil butanal
    4. 3-etil 4,4-dimetil pentanal
    5. 3,4-dietil 2,3-dimetil pentanal
    6. Jawaban: b

  28. 2-metil pentanal dapat dibuat dengan mengoksidasi paduan…
    1. 1-pentanol
    2. 2-metil 1-pentanol
    3. 2-metil 1-butanol
    4. 2-metil 2-pentanol
    5. 3-metil 1-pentanol
    6. Jawaban: b
      Alasan: Sintesis pada pertanyaan adalah aldehid. Aldehid saja dihasilkan dari oksidasi parsial alkohol primer dengan jumlah unsur C yang setimbang.

  29. Seseorang yang menderita ki kesulitan glikosuria melitus, air kencingnya jika diuji dengan menggunakan enceran Fehling karena gula mengandung gugus…
    1. alkohol
    2. eter
    3. alkanoat
    4. alkanon
    5. alkanal
    6. Jawaban: e

  30. Larutan aldehid yang digunakan untuk mengawetkan hewan percobaan adalah…
    1. formalin
    2. asam asetat
    3. asam formiat
    4. aseton
    5. alkohol
    6. Jawaban: a

  31. Aldehid dan keton n kepunyaan gugus fungsi yang sederajat, yaitu…
    1. gugus hidroksil
    2. gugus karbinol
    3. karboksilat
    4. gugus karbonil
    5. gugus amina
    6. Jawaban: d
      Alasan: Gugus fosgen adalah gugus di mana koalisi atom C rangkap terhadap unsur O. Sedangkan gugus karbinol adalah gugus di mana ikatan molekul C tunggal terhada anasir O.

  32. Stempel senyawa CH3CH(C2H5)CHO adalah…
    1. 2-etil propanal
    2. 2-etil 1-propanal
    3. 2-metil butanal
    4. 3-metil butanal
    5. 2-etil butanal
    6. Jawaban: c

  33. Nama senyawa berikut adalah…

    1. 1,1-dimetil 2-butanon
    2. 4,4-dimetil 2-butanon
    3. 4-metil 2-pentanon
    4. 2-metil 4-pentanon
    5. isopropil metil keton
    6. Jawaban: c

  34. Label campuran: CH3C(CH3)(C2H5)COC(CH3)2(C2H5) adalah…
    1. 2,4-dietil 2,4 dimetil 3-pentanon
    2. 2,2-dietil 4,4-dimetil 3-pentanon
    3. 3,3,5,5-tetrametil 4-heptanon
    4. 3,3-dietil 5,5-dimetil 4-heptanon
    5. 3,5-dietil 3,5-dimetil 3-heptanon
    6. Jawaban: c

  35. Keton bisa dibuat dengan prinsip mengoksdasi…
    1. alkohol primer
    2. bersut karboksilat
    3. ester
    4. alkohol sekunder
    5. aldehid
    6. Jawaban: d

  36. Senyawa dengan rumus: CH3-CH2-CO-CH3
    dihasilkan berusul reaksi oksidasi zat A. Zat A tersebut adalah…
    1. CH3-CH2-CH2-CHO
    2. CH3-CH2-CHOH-CH3
    3. CH3-CH2-O-CH2-CH3
    4. CH3-CH2-CH2OH
    5. CH3-CH2-CH2-COOH
    6. Jawaban: b
      Alasan: Keton yaitu hasil oksidasi segmental alkohol sekunder

  37. Sintesis dengan rumus molekul C5H10Ozon n kepunyaan isomer kasatmata aldehid dan keton yang masing-masing berjumlah…
    1. 4 dan 3
    2. 3 dan 4
    3. 5 dan 4
    4. 4 dan 5
    5. 4 dan 4
    6. Jawaban: a
      Alasan: Jumlah aldehid=4 (pentanal, 2-metil butanal, 3-metil butanal, 2,2-dimetil propanal) dan jumlah keton=3 (2-pentanon, 3-pentanon, 3-metil 2-pentanon)

  38. Reduksi aseton menghasilkan…
    1. asam asetat
    2. asetaldehid
    3. propil alkohol
    4. isopropil alkohol
    5. etanol
    6. Jawaban: d
      Alasan: Aseton (2-propanon) seandainya direduksi akan menghasilkan 2-propanol atau isopropil alkohol.

  39. Nama campuran berikut ialah…

    1. senderut 2,4-dietil 2-metil pentanoat
    2. asam 2,4-dietil 4-metil pentanoat
    3. asam 2-etil 2,4-dimetil heksanoat
    4. asam 4-etil 2,4-dimetil heksanoat
    5. senderut 4-etil 4-metil heksanoat
    6. Jawaban: c

  40. Jika 1,1 gram asam organik (R-COOH) tepat dinetralkan makanya 50 ml hancuran NaOH 0,25 M, maka bersut organik tersebut adalah…
    1. bersut asetat
    2. senderut butanoat
    3. cemberut heksanoat
    4. asam propanoat
    5. asam pentanoat
    6. Jawaban:

  41. Asam propionat dapat dibuat dengan mengoksidasi…
    1. CH3
      COCH3
    2. CH2
      OHCH2CH2
      OH
    3. CH3CH2
      OH
    4. CH3CHOHCH3
    5. CH3CH2
      CHO
    6. Jawaban: e
      Alasan: Asam propionat merupakan hasil oksidasi dari aldehid

  42. Asam asetat enggak digunakan lakukan…
    1. mengatur keasaman plong makanan
    2. mengawetkan makanan
    3. pembuatan incaran udara
    4. bahan protokoler pembuatan serat
    5. bahan baku pembuatan parfum dan esen buah-buahan
    6. Jawaban: e
      Alasan: ester adalah bahan baku pembuatan parfum dan esen buah-buahan

  43. Nama senyawa berikut adalah…

    1. asam 1,2,3-trihidroksi 1,2-pentadioat
    2. asam 2,3,4-trihidroksi 1,5-pentadioat
    3. senderut 1,2,3-triol 1,2-dipentanoat
    4. asam 2,3,4-triol 1,2-dipentanoat
    5. Asam trihidroksi pentadioat
    6. Jawaban: b

  44. Paduan C4H8O2
    yang bertabiat bersut berjumlah…
    1. 1
    2. 2
    3. 3
    4. 4
    5. 5
    6. Jawaban: b
      Alasan: Senyawa diatas nan berperilaku asam yakni asam alkanoat (asam butanoat dan asam 2-metil propanoat)

  45. Senyawa organik yang termasuk golongan paduan ester yaitu…
    1. metil asetat
    2. metil etil eter
    3. 2-metil butanal
    4. metil amina
    5. 3-metil butanal
    6. Jawaban: a

  46. Sintesis yang hasil reaksinya berupa ester merupakan…
    1. propanol dan natrium
    2. gliserol treiolet dan soda api
    3. asam oleat dan sodium hidroksida
    4. propanol dan fosfor trioksida
    5. etanol dan asam asetat
    6. Jawaban: e
      Alasan: Ester dapat dibuat berusul alkohol dan bersut alkanoat melalui proses esterifikasi yang menghasilkan ester dan air. Reaksi ini boleh bolak-balik.

  47. Hidrolisis butil asetat dalam suasana senderut menghasilkan…
    1. butanol dan cemberut etanoat
    2. etanol dan bersut butanoat
    3. butanol dan etanol
    4. asam etanoat dan asam butanoat
    5. butanol dan aseton
    6. Jawaban: a
      Alasan: (sebagai halnya nomor sebelumnya)

  48. Zat berikut nan tidak termasuk golongan ester adalah…
    1. minyak goreng
    2. esens pisang
    3. gula putih
    4. sarang madu
    5. gurih kambig
    6. Jawaban:

  49. Logo senyawa berikut yaitu…

    1. 2,5 dimetil 3-pentanon
    2. diisopropil keton
    3. diisopropil ester
    4. isobutil propanoat
    5. isopropil isobutirat
    6. Jawaban: c

  50. Reaksi berikut disebut reaksi…


    1. netralisasi
    2. penyabunan
    3. hidrolisis
    4. dekomposisi
    5. esterifikasi
    6. Jawaban: c

  51. Hidrolisis etil propionat menghasilkan…
    1. propil alkohol dan asam etanoat
    2. asam etanoat dan etil alkohol
    3. isopropil alkohol dan bersut etanoat
    4. bersut asetat dan asam propionat
    5. etanol dan asam propionat
    6. Jawaban: b

Lakukan soal-soal selanjutnya akan diposting kemudian karena butuh waktu yang cukup lama untuk mengetik soal-tanya di atas dan sisanya. Mohon abolisi.

Senyawa 2 Metil 1 Pentanol Berisomer Dengan

Source: http://pendidikan-ipa.blogspot.com/2010/01/jawaban-kimia.html

Baca :   Jalur Kedatangan Bangsa Barat Ke Indonesia

Check Also

Hukum Lenz Tentang Arah Arus Induksi

Hukum Lenz Tentang Arah Arus Induksi Hukum Lenz – Kembali lagi bersama dosenpintar.com, nah pada …